CAS 352431-38-0 appears in our catalog under these names: (±)-2-Ethylhexanoic-d15 Acid, 98 atom % D, min 98% Chemical Purity, 2-Ethylhexanoic acid-d15. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 0,5g, Get quote.
2,3,3,4,4,5,5,6,6,6-decadeuterio-2-(1,1,2,2,2-pentadeuterioethyl)hexanoic acid (CAS 352431-38-0) is a chemical compound with the molecular formula C8H16O2 and a molecular weight of 159.30 g/mol. IUPAC name: 2,3,3,4,4,5,5,6,6,6-decadeuterio-2-(1,1,2,2,2-pentadeuterioethyl)hexanoic acid. InChIKey: OBETXYAYXDNJHR-BKUSUEPDSA-N.
| Molecular formula | C8H16O2 |
|---|---|
| Molecular weight | 159.30 g/mol |
| IUPAC name | 2,3,3,4,4,5,5,6,6,6-decadeuterio-2-(1,1,2,2,2-pentadeuterioethyl)hexanoic acid |
| InChIKey | OBETXYAYXDNJHR-BKUSUEPDSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)