Products 145395-65-9
CAS 145395-65-9 is the registry number for 2-Ethyl-1-hexanol-D5. Offered by: TRC. Available pack sizes: 100mg.
2-(1,1,2,2,2-pentadeuterioethyl)hexan-1-ol (CAS 145395-65-9) is a chemical compound with the molecular formula C8H18O and a molecular weight of 135.26 g/mol. IUPAC name: 2-(1,1,2,2,2-pentadeuterioethyl)hexan-1-ol. InChIKey: YIWUKEYIRIRTPP-PVGOWFQYSA-N.
| Molecular formula | C8H18O |
|---|---|
| Molecular weight | 135.26 g/mol |
| IUPAC name | 2-(1,1,2,2,2-pentadeuterioethyl)hexan-1-ol |
| InChIKey | YIWUKEYIRIRTPP-PVGOWFQYSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(CCCC)CO |
Computed by PubChem (NCBI)