Products 202480-75-9
CAS 202480-75-9 appears in our catalog under these names: 2-Ethyl-1-hexanol-d17, (±)-2-Ethylhexyl-d17 Alcohol, 98 atom % D, min 98% Chemical Purity, 2–Ethyl–1–hexanol–d17, 2-Ethylhexan-1-ol-d17, D17-2-Ethyl-1-hexanol. Offered by: TRC, CDN, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 250mg, 25mg, 50mg, 0,25g, 0,1g, 5mg, 25 mg, 5 mg.
1,1,2,3,3,4,4,5,5,6,6,6-dodecadeuterio-2-(1,1,2,2,2-pentadeuterioethyl)hexan-1-ol (CAS 202480-75-9) is a chemical compound with the molecular formula C8H18O and a molecular weight of 147.33 g/mol. IUPAC name: 1,1,2,3,3,4,4,5,5,6,6,6-dodecadeuterio-2-(1,1,2,2,2-pentadeuterioethyl)hexan-1-ol. InChIKey: YIWUKEYIRIRTPP-MMDJZGHJSA-N.
| Molecular formula | C8H18O |
|---|---|
| Molecular weight | 147.33 g/mol |
| IUPAC name | 1,1,2,3,3,4,4,5,5,6,6,6-dodecadeuterio-2-(1,1,2,2,2-pentadeuterioethyl)hexan-1-ol |
| InChIKey | YIWUKEYIRIRTPP-MMDJZGHJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])(C([2H])([2H])C([2H])([2H])[2H])C([2H])([2H])O |
Computed by PubChem (NCBI)