CAS 1454-80-4 appears in our catalog under these names: 2,2'-Biphenyldiamine, 98%, Biphenyl-2,2'-diamine, 2,2'-Diaminobiphenyl, >99.0%(GC)(T), [1,1'-Biphenyl]-2,2'-diamine 96%, 2,2'-Diaminobiphenyl, 98%. Offered by: Combi-blocks, Biosynth, TCI, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 250mg, 500mg, 1000mg, 2000mg.
2-(2-aminophenyl)aniline (CAS 1454-80-4) is a chemical compound with the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. IUPAC name: 2-(2-aminophenyl)aniline. InChIKey: HOLGXWDGCVTMTB-UHFFFAOYSA-N.
| Molecular formula | C12H12N2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | 2-(2-aminophenyl)aniline |
| InChIKey | HOLGXWDGCVTMTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=C2N)N |
Computed by PubChem (NCBI)