CAS 145414-63-7 is the registry number for N-Acetyl 2-O-Benzyl Troxacitabine. Offered by: TRC. Available pack sizes: 50mg.
[(2S,4S)-4-(4-acetamido-2-oxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methyl benzoate (CAS 145414-63-7) is a chemical compound with the molecular formula C17H17N3O6 and a molecular weight of 359.3 g/mol. IUPAC name: [(2S,4S)-4-(4-acetamido-2-oxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methyl benzoate. InChIKey: BAODLFFHZLIRKZ-GJZGRUSLSA-N.
| Molecular formula | C17H17N3O6 |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | [(2S,4S)-4-(4-acetamido-2-oxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methyl benzoate |
| InChIKey | BAODLFFHZLIRKZ-GJZGRUSLSA-N |
| SMILES | CC(=O)NC1=NC(=O)N(C=C1)[C@@H]2CO[C@@H](O2)COC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)