CAS 2412056-31-4 is the registry number for 4-((2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)amino)butanoic acid, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]butanoic acid (CAS 2412056-31-4) is a chemical compound with the molecular formula C17H17N3O6 and a molecular weight of 359.3 g/mol. IUPAC name: 4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]butanoic acid. InChIKey: LCQFGIWWMKBYEX-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O6 |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | 4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]butanoic acid |
| InChIKey | LCQFGIWWMKBYEX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)NCCCC(=O)O |
Computed by PubChem (NCBI)