CAS 1454285-54-1 is the registry number for 4-Chloro-2-(2,4-dimethoxybenzyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-2-[(2,4-dimethoxyphenyl)methyl]-1,3-dihydropyrrolo[3,4-c]pyridine (CAS 1454285-54-1) is a chemical compound with the molecular formula C16H17ClN2O2 and a molecular weight of 304.77 g/mol. IUPAC name: 4-chloro-2-[(2,4-dimethoxyphenyl)methyl]-1,3-dihydropyrrolo[3,4-c]pyridine. InChIKey: XKAMAGMIVGRURW-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN2O2 |
|---|---|
| Molecular weight | 304.77 g/mol |
| IUPAC name | 4-chloro-2-[(2,4-dimethoxyphenyl)methyl]-1,3-dihydropyrrolo[3,4-c]pyridine |
| InChIKey | XKAMAGMIVGRURW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CN2CC3=C(C2)C(=NC=C3)Cl)OC |
Computed by PubChem (NCBI)