Products 1589504-29-9
CAS 1589504-29-9 is the registry number for 3-Chloro-1-(4-(2-oxopiperidin-1-yl)phenyl)-5,6-dihydropyridin-2(1H)-one. Offered by: TRC. Available pack sizes: 100mg.
5-chloro-1-[4-(2-oxopiperidin-1-yl)phenyl]-2,3-dihydropyridin-6-one (CAS 1589504-29-9) is a chemical compound with the molecular formula C16H17ClN2O2 and a molecular weight of 304.77 g/mol. IUPAC name: 5-chloro-1-[4-(2-oxopiperidin-1-yl)phenyl]-2,3-dihydropyridin-6-one. InChIKey: BQTIXBKYLJNTDF-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN2O2 |
|---|---|
| Molecular weight | 304.77 g/mol |
| IUPAC name | 5-chloro-1-[4-(2-oxopiperidin-1-yl)phenyl]-2,3-dihydropyridin-6-one |
| InChIKey | BQTIXBKYLJNTDF-UHFFFAOYSA-N |
| SMILES | C1CCN(C(=O)C1)C2=CC=C(C=C2)N3CCC=C(C3=O)Cl |
Computed by PubChem (NCBI)