Products 1454704-90-5
CAS 1454704-90-5 is the registry number for 5-Bromo-N,N-dimethyl-1H-indole-1-carboxamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
5-bromo-N,N-dimethylindole-1-carboxamide (CAS 1454704-90-5) is a chemical compound with the molecular formula C11H11BrN2O and a molecular weight of 267.12 g/mol. IUPAC name: 5-bromo-N,N-dimethylindole-1-carboxamide. InChIKey: XIOMLUWURYVGOK-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | 5-bromo-N,N-dimethylindole-1-carboxamide |
| InChIKey | XIOMLUWURYVGOK-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)N1C=CC2=C1C=CC(=C2)Br |
Computed by PubChem (NCBI)