Products 145475-35-0
CAS 145475-35-0 is the registry number for 2-(Chloromethyl)-5,6,7,8-tetrahydroquinazolin-4(3H)-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(chloromethyl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one (CAS 145475-35-0) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 2-(chloromethyl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one. InChIKey: YOEVSDYLLYABRV-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 2-(chloromethyl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
| InChIKey | YOEVSDYLLYABRV-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=O)NC(=N2)CCl |
Computed by PubChem (NCBI)