CAS 1454814-96-0 is the registry number for (1,6-Dimethyl-2-oxo-1,2-dihydropyridin-3-yl)boronic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(1,6-dimethyl-2-oxo-3-pyridinyl)boronic acid (CAS 1454814-96-0) is a chemical compound with the molecular formula C7H10BNO3 and a molecular weight of 166.97 g/mol. IUPAC name: (1,6-dimethyl-2-oxo-3-pyridinyl)boronic acid. InChIKey: NWPRZOPXLBPZCK-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO3 |
|---|---|
| Molecular weight | 166.97 g/mol |
| IUPAC name | (1,6-dimethyl-2-oxo-3-pyridinyl)boronic acid |
| InChIKey | NWPRZOPXLBPZCK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(N(C1=O)C)C)(O)O |
Computed by PubChem (NCBI)