Products 1454816-10-4
CAS 1454816-10-4 is the registry number for Fmoc-L-Tyr(2-azidoethyl)-OH. Offered by: Iris Biotech, MedChemExpress. Available pack sizes: 250mg, 500mg, 1g, 5g, 25g, Get quote.
(2S)-3-[4-(2-azidoethoxy)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1454816-10-4) is a chemical compound with the molecular formula C26H24N4O5 and a molecular weight of 472.5 g/mol. IUPAC name: (2S)-3-[4-(2-azidoethoxy)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: OEXYEZJGYOWMNJ-DEOSSOPVSA-N.
| Molecular formula | C26H24N4O5 |
|---|---|
| Molecular weight | 472.5 g/mol |
| IUPAC name | (2S)-3-[4-(2-azidoethoxy)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | OEXYEZJGYOWMNJ-DEOSSOPVSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)OCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)