CAS 145489-90-3 appears in our catalog under these names: 6-Bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-one 98%, 6-Bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-one, 98%, 98%, 6-Bromo-2,3,4,9-tetrahydro-beta-carbolin-1-one. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-bromo-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one (CAS 145489-90-3) is a chemical compound with the molecular formula C11H9BrN2O and a molecular weight of 265.11 g/mol. IUPAC name: 6-bromo-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one. InChIKey: PRAZBPXVGIVRCS-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O |
|---|---|
| Molecular weight | 265.11 g/mol |
| IUPAC name | 6-bromo-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one |
| InChIKey | PRAZBPXVGIVRCS-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C1C3=C(N2)C=CC(=C3)Br |
Computed by PubChem (NCBI)