CAS 1455381-71-1 appears in our catalog under these names: 1-Benzyl-4-(3,4-dichlorophenyl)-1H-imidazol-5-amine, 95%, 1-Benzyl-4-(3,4-dichlorophenyl)-1H-imidazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-benzyl-5-(3,4-dichlorophenyl)imidazol-4-amine (CAS 1455381-71-1) is a chemical compound with the molecular formula C16H13Cl2N3 and a molecular weight of 318.2 g/mol. IUPAC name: 3-benzyl-5-(3,4-dichlorophenyl)imidazol-4-amine. InChIKey: HFUHUGRDWPZSPJ-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2N3 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | 3-benzyl-5-(3,4-dichlorophenyl)imidazol-4-amine |
| InChIKey | HFUHUGRDWPZSPJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NC(=C2N)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)