Products 2584980-96-9
CAS 2584980-96-9 is the registry number for 7-Benzyl-2,4-dichloro-5,6,7,8-tetrahydro-1,7-naphthyridine-3-carbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-benzyl-2,4-dichloro-6,8-dihydro-5H-1,7-naphthyridine-3-carbonitrile (CAS 2584980-96-9) is a chemical compound with the molecular formula C16H13Cl2N3 and a molecular weight of 318.2 g/mol. IUPAC name: 7-benzyl-2,4-dichloro-6,8-dihydro-5H-1,7-naphthyridine-3-carbonitrile. InChIKey: BOYZBQWEVVLVBL-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2N3 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | 7-benzyl-2,4-dichloro-6,8-dihydro-5H-1,7-naphthyridine-3-carbonitrile |
| InChIKey | BOYZBQWEVVLVBL-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C(=C(C(=N2)Cl)C#N)Cl)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)