Products 1456696-03-9
CAS 1456696-03-9 is the registry number for 6-Thiofucose Pentaacetate. Offered by: TRC. Available pack sizes: 10mg.
[(2R,3S,4R,5S)-4,5,6-triacetyloxy-2-(acetylsulfanylmethyl)oxan-3-yl] acetate (CAS 1456696-03-9) is a chemical compound with the molecular formula C16H22O10S and a molecular weight of 406.4 g/mol. IUPAC name: [(2R,3S,4R,5S)-4,5,6-triacetyloxy-2-(acetylsulfanylmethyl)oxan-3-yl] acetate. InChIKey: BTEKCGJCPLXBRE-JSKHOMAGSA-N.
| Molecular formula | C16H22O10S |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | [(2R,3S,4R,5S)-4,5,6-triacetyloxy-2-(acetylsulfanylmethyl)oxan-3-yl] acetate |
| InChIKey | BTEKCGJCPLXBRE-JSKHOMAGSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC([C@H]([C@@H]1OC(=O)C)OC(=O)C)OC(=O)C)CSC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
6-Thiofucose Pentaacetate