CAS 62860-10-0 is the registry number for 2,3,4,6-tetra-o-acetyl-1-s-acetyl-1-thio-|A-d-glucopyranose. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-acetylsulfanyloxan-2-yl]methyl acetate (CAS 62860-10-0) is a chemical compound with the molecular formula C16H22O10S and a molecular weight of 406.4 g/mol. IUPAC name: [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-acetylsulfanyloxan-2-yl]methyl acetate. InChIKey: CFAJEDWNNGFOQV-IBEHDNSVSA-N.
| Molecular formula | C16H22O10S |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-acetylsulfanyloxan-2-yl]methyl acetate |
| InChIKey | CFAJEDWNNGFOQV-IBEHDNSVSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)SC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)