CAS 145678-87-1 is the registry number for (-)-(3S,4S)-3,4-Dimethyl-4-(3-hydroxyphenyl)piperidine. Offered by: TRC. Available pack sizes: 500mg.
3-[(3S,4S)-3,4-dimethylpiperidin-4-yl]phenol (CAS 145678-87-1) is a chemical compound with the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. IUPAC name: 3-[(3S,4S)-3,4-dimethylpiperidin-4-yl]phenol. InChIKey: HXZDAOSDNCHKFE-MFKMUULPSA-N.
| Molecular formula | C13H19NO |
|---|---|
| Molecular weight | 205.30 g/mol |
| IUPAC name | 3-[(3S,4S)-3,4-dimethylpiperidin-4-yl]phenol |
| InChIKey | HXZDAOSDNCHKFE-MFKMUULPSA-N |
| SMILES | C[C@@H]1CNCC[C@]1(C)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)