CAS 1980007-99-5 is the registry number for 3-((3R,4S)-3,4-Dimethylpiperidin-4-yl)phenol. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
3-[(3R,4S)-3,4-dimethylpiperidin-4-yl]phenol (CAS 1980007-99-5) is a chemical compound with the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. IUPAC name: 3-[(3R,4S)-3,4-dimethylpiperidin-4-yl]phenol. InChIKey: HXZDAOSDNCHKFE-GWCFXTLKSA-N.
| Molecular formula | C13H19NO |
|---|---|
| Molecular weight | 205.30 g/mol |
| IUPAC name | 3-[(3R,4S)-3,4-dimethylpiperidin-4-yl]phenol |
| InChIKey | HXZDAOSDNCHKFE-GWCFXTLKSA-N |
| SMILES | C[C@H]1CNCC[C@]1(C)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)