Products 14575-25-8
CAS 14575-25-8 is the registry number for (2E,4E)-1-Phenyl-4-(1,3,3-trimethyl-1,3-dihydro-2h-indol-2-ylidene)but-2-en-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
(E,4E)-1-phenyl-4-(1,3,3-trimethylindol-2-ylidene)but-2-en-1-one (CAS 14575-25-8) is a chemical compound with the molecular formula C21H21NO and a molecular weight of 303.4 g/mol. IUPAC name: (E,4E)-1-phenyl-4-(1,3,3-trimethylindol-2-ylidene)but-2-en-1-one. InChIKey: FWAPKZOTGYVZSA-IFIIVODNSA-N.
| Molecular formula | C21H21NO |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | (E,4E)-1-phenyl-4-(1,3,3-trimethylindol-2-ylidene)but-2-en-1-one |
| InChIKey | FWAPKZOTGYVZSA-IFIIVODNSA-N |
| SMILES | CC\1(C2=CC=CC=C2N(/C1=C/C=C/C(=O)C3=CC=CC=C3)C)C |
Computed by PubChem (NCBI)