CAS 153322-11-3 is the registry number for (1R,2S)-N-Benzyl-2-amino-1,2-diphenylethanol, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(1R,2S)-2-(benzylamino)-1,2-diphenylethanol (CAS 153322-11-3) is a chemical compound with the molecular formula C21H21NO and a molecular weight of 303.4 g/mol. IUPAC name: (1R,2S)-2-(benzylamino)-1,2-diphenylethanol. InChIKey: KKJGAZRIFJEPKA-LEWJYISDSA-N.
| Molecular formula | C21H21NO |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | (1R,2S)-2-(benzylamino)-1,2-diphenylethanol |
| InChIKey | KKJGAZRIFJEPKA-LEWJYISDSA-N |
| SMILES | C1=CC=C(C=C1)CN[C@@H](C2=CC=CC=C2)[C@@H](C3=CC=CC=C3)O |
Computed by PubChem (NCBI)