CAS 1458028-73-3 is the registry number for 2-(Benzyloxy)pyridine-4-carboxamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-phenylmethoxypyridine-4-carboxamide (CAS 1458028-73-3) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: 2-phenylmethoxypyridine-4-carboxamide. InChIKey: NILSYOBBXYBYQC-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 2-phenylmethoxypyridine-4-carboxamide |
| InChIKey | NILSYOBBXYBYQC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC=CC(=C2)C(=O)N |
Computed by PubChem (NCBI)