Products 1458481-93-0
CAS 1458481-93-0 is the registry number for 4-Bromo-N-tert-butyl-2-chlorobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-bromo-N-tert-butyl-2-chlorobenzamide (CAS 1458481-93-0) is a chemical compound with the molecular formula C11H13BrClNO and a molecular weight of 290.58 g/mol. IUPAC name: 4-bromo-N-tert-butyl-2-chlorobenzamide. InChIKey: OFXSAIBJUHEQCH-UHFFFAOYSA-N.
| Molecular formula | C11H13BrClNO |
|---|---|
| Molecular weight | 290.58 g/mol |
| IUPAC name | 4-bromo-N-tert-butyl-2-chlorobenzamide |
| InChIKey | OFXSAIBJUHEQCH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)