CAS 682778-17-2 is the registry number for N,N-Diethyl 4-bromo-2-chlorobenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 25g.
4-bromo-2-chloro-N,N-diethylbenzamide (CAS 682778-17-2) is a chemical compound with the molecular formula C11H13BrClNO and a molecular weight of 290.58 g/mol. IUPAC name: 4-bromo-2-chloro-N,N-diethylbenzamide. InChIKey: IFMVHORCFRIXQD-UHFFFAOYSA-N.
| Molecular formula | C11H13BrClNO |
|---|---|
| Molecular weight | 290.58 g/mol |
| IUPAC name | 4-bromo-2-chloro-N,N-diethylbenzamide |
| InChIKey | IFMVHORCFRIXQD-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)