Products 1458653-20-7
CAS 1458653-20-7 is the registry number for 3-(4-Bromo-3,5-dimethyl-phenoxymethyl)-azetidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Tert-butyl 3-[(4-bromo-3,5-dimethylphenoxy)methyl]azetidine-1-carboxylate (CAS 1458653-20-7) is a chemical compound with the molecular formula C17H24BrNO3 and a molecular weight of 370.3 g/mol. IUPAC name: tert-butyl 3-[(4-bromo-3,5-dimethylphenoxy)methyl]azetidine-1-carboxylate. InChIKey: MRSXSOLVVYXSBH-UHFFFAOYSA-N.
| Molecular formula | C17H24BrNO3 |
|---|---|
| Molecular weight | 370.3 g/mol |
| IUPAC name | tert-butyl 3-[(4-bromo-3,5-dimethylphenoxy)methyl]azetidine-1-carboxylate |
| InChIKey | MRSXSOLVVYXSBH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)OCC2CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)