Products 6415-90-3
CAS 6415-90-3 is the registry number for Atropine (hydrobromide). Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;hydrobromide (CAS 6415-90-3) is a chemical compound with the molecular formula C17H24BrNO3 and a molecular weight of 370.3 g/mol. IUPAC name: [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;hydrobromide. InChIKey: VZDNSFSBCMCXSK-ZZJGABIISA-N.
| Molecular formula | C17H24BrNO3 |
|---|---|
| Molecular weight | 370.3 g/mol |
| IUPAC name | [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;hydrobromide |
| InChIKey | VZDNSFSBCMCXSK-ZZJGABIISA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)C(CO)C3=CC=CC=C3.Br |
Computed by PubChem (NCBI)