CAS 1459284-52-6 is the registry number for 2-Methoxyethyl 4-fluoro-3-nitrobenzoate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-methoxyethyl 4-fluoro-3-nitrobenzoate (CAS 1459284-52-6) is a chemical compound with the molecular formula C10H10FNO5 and a molecular weight of 243.19 g/mol. IUPAC name: 2-methoxyethyl 4-fluoro-3-nitrobenzoate. InChIKey: UUGVRGULFIWQQQ-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO5 |
|---|---|
| Molecular weight | 243.19 g/mol |
| IUPAC name | 2-methoxyethyl 4-fluoro-3-nitrobenzoate |
| InChIKey | UUGVRGULFIWQQQ-UHFFFAOYSA-N |
| SMILES | COCCOC(=O)C1=CC(=C(C=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)