Products 2763850-49-1
CAS 2763850-49-1 is the registry number for Methyl 5-fluoro-4-(2-hydroxyethyl)-2-nitrobenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-fluoro-4-(2-hydroxyethyl)-2-nitrobenzoate (CAS 2763850-49-1) is a chemical compound with the molecular formula C10H10FNO5 and a molecular weight of 243.19 g/mol. IUPAC name: methyl 5-fluoro-4-(2-hydroxyethyl)-2-nitrobenzoate. InChIKey: XZIFYHFYIDORQG-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO5 |
|---|---|
| Molecular weight | 243.19 g/mol |
| IUPAC name | methyl 5-fluoro-4-(2-hydroxyethyl)-2-nitrobenzoate |
| InChIKey | XZIFYHFYIDORQG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C(=C1)F)CCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)