Products 1459693-80-1
CAS 1459693-80-1 is the registry number for 1,2-Bis(3-bromophenyl)ethane-1,2-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-bis(3-bromophenyl)ethane-1,2-diamine (CAS 1459693-80-1) is a chemical compound with the molecular formula C14H14Br2N2 and a molecular weight of 370.08 g/mol. IUPAC name: 1,2-bis(3-bromophenyl)ethane-1,2-diamine. InChIKey: ZDBDQKXPNYRIKQ-UHFFFAOYSA-N.
| Molecular formula | C14H14Br2N2 |
|---|---|
| Molecular weight | 370.08 g/mol |
| IUPAC name | 1,2-bis(3-bromophenyl)ethane-1,2-diamine |
| InChIKey | ZDBDQKXPNYRIKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C(C2=CC(=CC=C2)Br)N)N |
Computed by PubChem (NCBI)