Products 1807753-02-1
CAS 1807753-02-1 is the registry number for 3,5-Dibromo-N-mesityl-2-aminopyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
3,5-dibromo-N-(2,4,6-trimethylphenyl)pyridin-2-amine (CAS 1807753-02-1) is a chemical compound with the molecular formula C14H14Br2N2 and a molecular weight of 370.08 g/mol. IUPAC name: 3,5-dibromo-N-(2,4,6-trimethylphenyl)pyridin-2-amine. InChIKey: QRXVGONLPFJAJA-UHFFFAOYSA-N.
| Molecular formula | C14H14Br2N2 |
|---|---|
| Molecular weight | 370.08 g/mol |
| IUPAC name | 3,5-dibromo-N-(2,4,6-trimethylphenyl)pyridin-2-amine |
| InChIKey | QRXVGONLPFJAJA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC2=C(C=C(C=N2)Br)Br)C |
Computed by PubChem (NCBI)