Products 145971-08-0
CAS 145971-08-0 is the registry number for Justicidin G. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.
9-(6-hydroxy-1,3-benzodioxol-5-yl)-4,6,7-trimethoxy-3H-benzo[f][2]benzofuran-1-one (CAS 145971-08-0) is a chemical compound with the molecular formula C22H18O8 and a molecular weight of 410.4 g/mol. IUPAC name: 9-(6-hydroxy-1,3-benzodioxol-5-yl)-4,6,7-trimethoxy-3H-benzo[f][2]benzofuran-1-one. InChIKey: DFVZQTUMRRMHEL-UHFFFAOYSA-N.
| Molecular formula | C22H18O8 |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | 9-(6-hydroxy-1,3-benzodioxol-5-yl)-4,6,7-trimethoxy-3H-benzo[f][2]benzofuran-1-one |
| InChIKey | DFVZQTUMRRMHEL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=C3C(=C2OC)COC3=O)C4=CC5=C(C=C4O)OCO5)OC |
Computed by PubChem (NCBI)