Products 904328-26-3
CAS 904328-26-3 appears in our catalog under these names: 6'-Hydroxyjusticidin C, ≥98%, ≥98%, 6′-Hydroxyjusticidin C. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, 5 mg, 10 mg, 1 mg.
9-(6-hydroxy-1,3-benzodioxol-5-yl)-4,6,7-trimethoxy-1H-benzo[f][2]benzofuran-3-one (CAS 904328-26-3) is a chemical compound with the molecular formula C22H18O8 and a molecular weight of 410.4 g/mol. IUPAC name: 9-(6-hydroxy-1,3-benzodioxol-5-yl)-4,6,7-trimethoxy-1H-benzo[f][2]benzofuran-3-one. InChIKey: UMOJJWBCGIBDRN-UHFFFAOYSA-N.
| Molecular formula | C22H18O8 |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | 9-(6-hydroxy-1,3-benzodioxol-5-yl)-4,6,7-trimethoxy-1H-benzo[f][2]benzofuran-3-one |
| InChIKey | UMOJJWBCGIBDRN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=C3COC(=O)C3=C2OC)C4=CC5=C(C=C4O)OCO5)OC |
Computed by PubChem (NCBI)