CAS 1460-02-2 appears in our catalog under these names: 1,3,5-Tri-tert-butylbenzene, >95% (HPLC), 1,3,5–Tri–tert–butylbenzene, 1,3,5-Tri-tert-butylbenzene, 97+% , 1,3,5-Tri-tert-butylbenzene, >98.0%(GC), 1,3,5-Tri-tert-butylbenzene 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 2,5g, 250mg, 500mg, 100g, 500g, 10g, 50g, 5g.
1,3,5-tritert-butylbenzene (CAS 1460-02-2) is a chemical compound with the molecular formula C18H30 and a molecular weight of 246.4 g/mol. IUPAC name: 1,3,5-tritert-butylbenzene. InChIKey: GUFMBISUSZUUCB-UHFFFAOYSA-N.
| Molecular formula | C18H30 |
|---|---|
| Molecular weight | 246.4 g/mol |
| IUPAC name | 1,3,5-tritert-butylbenzene |
| InChIKey | GUFMBISUSZUUCB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C(C)(C)C)C(C)(C)C |
Computed by PubChem (NCBI)