CAS 27322-46-9 is the registry number for 1,2,4,5-Tetraisopropylbenzene. Offered by: TRC. Available pack sizes: 500mg.
1,2,4,5-tetra(propan-2-yl)benzene (CAS 27322-46-9) is a chemical compound with the molecular formula C18H30 and a molecular weight of 246.4 g/mol. IUPAC name: 1,2,4,5-tetra(propan-2-yl)benzene. InChIKey: ROXLYQQDLJJEBE-UHFFFAOYSA-N.
| Molecular formula | C18H30 |
|---|---|
| Molecular weight | 246.4 g/mol |
| IUPAC name | 1,2,4,5-tetra(propan-2-yl)benzene |
| InChIKey | ROXLYQQDLJJEBE-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1C(C)C)C(C)C)C(C)C |
Computed by PubChem (NCBI)