Products 146062-46-6
CAS 146062-46-6 appears in our catalog under these names: 1-Hydroxy Pioglitazone Hydrochloride, Leriglitazone hydrochloride, Leriglitazone (hydrochloride), 99%, 99%, Leriglitazone (hydrochloride), 99.64%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 25mg, 5mg, 10mg, 50mg, 1mg, 100 mg, 5 mg, 25 mg.
5-[[4-[2-[5-(1-hydroxyethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride (CAS 146062-46-6) is a chemical compound with the molecular formula C19H21ClN2O4S and a molecular weight of 408.9 g/mol. IUPAC name: 5-[[4-[2-[5-(1-hydroxyethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride. InChIKey: SBHOQYCDAHAMDW-UHFFFAOYSA-N.
| Molecular formula | C19H21ClN2O4S |
|---|---|
| Molecular weight | 408.9 g/mol |
| IUPAC name | 5-[[4-[2-[5-(1-hydroxyethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride |
| InChIKey | SBHOQYCDAHAMDW-UHFFFAOYSA-N |
| SMILES | CC(C1=CN=C(C=C1)CCOC2=CC=C(C=C2)CC3C(=O)NC(=O)S3)O.Cl |
Computed by PubChem (NCBI)