Products 1485294-22-1
CAS 1485294-22-1 appears in our catalog under these names: (R)-Tianeptine Metabolite MC5, (R)-Pentanoic Acid Tianeptine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
5-[[(11R)-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl]amino]pentanoic acid (CAS 1485294-22-1) is a chemical compound with the molecular formula C19H21ClN2O4S and a molecular weight of 408.9 g/mol. IUPAC name: 5-[[(11R)-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl]amino]pentanoic acid. InChIKey: BYPYVXCZPZLHBO-LJQANCHMSA-N.
| Molecular formula | C19H21ClN2O4S |
|---|---|
| Molecular weight | 408.9 g/mol |
| IUPAC name | 5-[[(11R)-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl]amino]pentanoic acid |
| InChIKey | BYPYVXCZPZLHBO-LJQANCHMSA-N |
| SMILES | CN1C2=CC=CC=C2[C@H](C3=C(S1(=O)=O)C=C(C=C3)Cl)NCCCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(R)-Pentanoic Acid Tianeptine