CAS 146117-78-4 is the registry number for LY191704. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4aS,10bS)-8-chloro-4-methyl-1,2,4a,5,6,10b-hexahydrobenzo[f]quinolin-3-one (CAS 146117-78-4) is a chemical compound with the molecular formula C14H16ClNO and a molecular weight of 249.73 g/mol. IUPAC name: (4aS,10bS)-8-chloro-4-methyl-1,2,4a,5,6,10b-hexahydrobenzo[f]quinolin-3-one. InChIKey: WQBIOEFDDDEARX-STQMWFEESA-N.
| Molecular formula | C14H16ClNO |
|---|---|
| Molecular weight | 249.73 g/mol |
| IUPAC name | (4aS,10bS)-8-chloro-4-methyl-1,2,4a,5,6,10b-hexahydrobenzo[f]quinolin-3-one |
| InChIKey | WQBIOEFDDDEARX-STQMWFEESA-N |
| SMILES | CN1[C@H]2CCC3=C([C@@H]2CCC1=O)C=CC(=C3)Cl |
Computed by PubChem (NCBI)