CAS 1461705-21-4 appears in our catalog under these names: 1-(Azetidin-3-yl)-1H-1,2,3-triazole-4-carboxamide hydrochloride, 98%, 1-(Azetidin-3-yl)-1H-1,2,3-triazole-4-carboxamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(azetidin-3-yl)triazole-4-carboxamide;hydrochloride (CAS 1461705-21-4) is a chemical compound with the molecular formula C6H10ClN5O and a molecular weight of 203.63 g/mol. IUPAC name: 1-(azetidin-3-yl)triazole-4-carboxamide;hydrochloride. InChIKey: LGQZTNWLLSENJQ-UHFFFAOYSA-N.
| Molecular formula | C6H10ClN5O |
|---|---|
| Molecular weight | 203.63 g/mol |
| IUPAC name | 1-(azetidin-3-yl)triazole-4-carboxamide;hydrochloride |
| InChIKey | LGQZTNWLLSENJQ-UHFFFAOYSA-N |
| SMILES | C1C(CN1)N2C=C(N=N2)C(=O)N.Cl |
Computed by PubChem (NCBI)