CAS 5752-25-0 is the registry number for Tetrahydropterin bis-Hydrochloride. Offered by: TRC. Available pack sizes: 10mg.
2-amino-5,6,7,8-tetrahydro-3H-pteridin-4-one;hydrochloride (CAS 5752-25-0) is a chemical compound with the molecular formula C6H10ClN5O and a molecular weight of 203.63 g/mol. IUPAC name: 2-amino-5,6,7,8-tetrahydro-3H-pteridin-4-one;hydrochloride. InChIKey: YYEPSSBCPLFLPT-UHFFFAOYSA-N.
| Molecular formula | C6H10ClN5O |
|---|---|
| Molecular weight | 203.63 g/mol |
| IUPAC name | 2-amino-5,6,7,8-tetrahydro-3H-pteridin-4-one;hydrochloride |
| InChIKey | YYEPSSBCPLFLPT-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(N1)C(=O)NC(=N2)N.Cl |
Computed by PubChem (NCBI)