CAS 1461705-34-9 appears in our catalog under these names: Benzyl 2-sulfamoylpropanoate, 95%, Benzyl 2-sulfamoylpropanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Benzyl 2-sulfamoylpropanoate (CAS 1461705-34-9) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: benzyl 2-sulfamoylpropanoate. InChIKey: MSBFGVHVVGCDEN-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | benzyl 2-sulfamoylpropanoate |
| InChIKey | MSBFGVHVVGCDEN-UHFFFAOYSA-N |
| SMILES | CC(C(=O)OCC1=CC=CC=C1)S(=O)(=O)N |
Computed by PubChem (NCBI)