CAS 1461705-75-8 appears in our catalog under these names: 2-Amino-3-(3,5-dimethyl-1H-pyrazol-1-yl)propanoic acid dihydrochloride, 95%, 2-Amino-3-(3,5-dimethyl-1H-pyrazol-1-yl)propanoic acid dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
2-amino-3-(3,5-dimethylpyrazol-1-yl)propanoic acid;dihydrochloride (CAS 1461705-75-8) is a chemical compound with the molecular formula C8H15Cl2N3O2 and a molecular weight of 256.13 g/mol. IUPAC name: 2-amino-3-(3,5-dimethylpyrazol-1-yl)propanoic acid;dihydrochloride. InChIKey: SQRNUZZYLCGPMV-UHFFFAOYSA-N.
| Molecular formula | C8H15Cl2N3O2 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | 2-amino-3-(3,5-dimethylpyrazol-1-yl)propanoic acid;dihydrochloride |
| InChIKey | SQRNUZZYLCGPMV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CC(C(=O)O)N)C.Cl.Cl |
Computed by PubChem (NCBI)