Products 37792-68-0
CAS 37792-68-0 appears in our catalog under these names: Methyl Np-methyl-L-histidinate dihydrochloride, 98%, Methyl Nπ-methyl-L-histidinate dihydrochloride, 98%, 98%, Methyl NÏ€-methyl-L-histidinate dihydrochloride, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg.
Methyl (2S)-2-amino-3-(3-methylimidazol-4-yl)propanoate;dihydrochloride (CAS 37792-68-0) is a chemical compound with the molecular formula C8H15Cl2N3O2 and a molecular weight of 256.13 g/mol. IUPAC name: methyl (2S)-2-amino-3-(3-methylimidazol-4-yl)propanoate;dihydrochloride. InChIKey: RKQQFZCGJKMSPA-KLXURFKVSA-N.
| Molecular formula | C8H15Cl2N3O2 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(3-methylimidazol-4-yl)propanoate;dihydrochloride |
| InChIKey | RKQQFZCGJKMSPA-KLXURFKVSA-N |
| SMILES | CN1C=NC=C1C[C@@H](C(=O)OC)N.Cl.Cl |
Computed by PubChem (NCBI)