CAS 1461705-95-2 is the registry number for 3-(1H-1,2,3-Triazol-1-yl)phenol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(triazol-1-yl)phenol (CAS 1461705-95-2) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 3-(triazol-1-yl)phenol. InChIKey: AVOLDLWDCJIADF-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 3-(triazol-1-yl)phenol |
| InChIKey | AVOLDLWDCJIADF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)N2C=CN=N2 |
Computed by PubChem (NCBI)