CAS 1461706-10-4 appears in our catalog under these names: 3-(1H-1,2,3-Triazol-4-yl)aniline dihydrochloride, 3-(1H-1,2,3-Triazol-4-yl)aniline dihydrochloride, 95%, 95%, 3-(1H-1,2,3-triazol-4-yl)aniline dihydrochloride, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
3-(2H-triazol-4-yl)aniline;dihydrochloride (CAS 1461706-10-4) is a chemical compound with the molecular formula C8H10Cl2N4 and a molecular weight of 233.09 g/mol. IUPAC name: 3-(2H-triazol-4-yl)aniline;dihydrochloride. InChIKey: AODYOQRLJMHSMN-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N4 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 3-(2H-triazol-4-yl)aniline;dihydrochloride |
| InChIKey | AODYOQRLJMHSMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=NNN=C2.Cl.Cl |
Computed by PubChem (NCBI)