CAS 1798736-93-2 appears in our catalog under these names: 4-(4H-1,2,4-Triazol-4-yl)aniline dihydrochloride, 95%, 4-(4H-1,2,4-Triazol-4-yl)aniline dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g.
4-(1,2,4-triazol-4-yl)aniline;dihydrochloride (CAS 1798736-93-2) is a chemical compound with the molecular formula C8H10Cl2N4 and a molecular weight of 233.09 g/mol. IUPAC name: 4-(1,2,4-triazol-4-yl)aniline;dihydrochloride. InChIKey: YFFLZKAWAXNHIQ-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N4 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 4-(1,2,4-triazol-4-yl)aniline;dihydrochloride |
| InChIKey | YFFLZKAWAXNHIQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N2C=NN=C2.Cl.Cl |
Computed by PubChem (NCBI)