CAS 1461706-31-9 appears in our catalog under these names: 2-(Bromomethyl)-5-methyl-4H,7H-(1,2,4)triazolo(1,5-a)pyrimidin-7-one, 95%, 2-(Bromomethyl)-5-methyl-4H,7H-(1,2,4)triazolo(1,5-a)pyrimidin-7-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(bromomethyl)-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 1461706-31-9) is a chemical compound with the molecular formula C7H7BrN4O and a molecular weight of 243.06 g/mol. IUPAC name: 2-(bromomethyl)-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: XORDKVBKDNMUCU-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN4O |
|---|---|
| Molecular weight | 243.06 g/mol |
| IUPAC name | 2-(bromomethyl)-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | XORDKVBKDNMUCU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=N1)N=C(N2)CBr |
Computed by PubChem (NCBI)