CAS 1911567-45-7 is the registry number for (4-Amino-7-bromopyrrolo[2,1-f][1,2,4]triazin-5-yl)methanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-amino-7-bromopyrrolo[2,1-f][1,2,4]triazin-5-yl)methanol (CAS 1911567-45-7) is a chemical compound with the molecular formula C7H7BrN4O and a molecular weight of 243.06 g/mol. IUPAC name: (4-amino-7-bromopyrrolo[2,1-f][1,2,4]triazin-5-yl)methanol. InChIKey: NSLKZCNXMVMLCG-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN4O |
|---|---|
| Molecular weight | 243.06 g/mol |
| IUPAC name | (4-amino-7-bromopyrrolo[2,1-f][1,2,4]triazin-5-yl)methanol |
| InChIKey | NSLKZCNXMVMLCG-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=C1CO)C(=NC=N2)N)Br |
Computed by PubChem (NCBI)