CAS 1461707-75-4 appears in our catalog under these names: N-Amino-2-(3-bromophenyl)ethanimidamide hydrochloride, 95%, N-Amino-2-(3-bromophenyl)ethanimidamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
N'-amino-2-(3-bromophenyl)ethanimidamide;hydrochloride (CAS 1461707-75-4) is a chemical compound with the molecular formula C8H11BrClN3 and a molecular weight of 264.55 g/mol. IUPAC name: N'-amino-2-(3-bromophenyl)ethanimidamide;hydrochloride. InChIKey: GHEJOVTUBDNGBA-UHFFFAOYSA-N.
| Molecular formula | C8H11BrClN3 |
|---|---|
| Molecular weight | 264.55 g/mol |
| IUPAC name | N'-amino-2-(3-bromophenyl)ethanimidamide;hydrochloride |
| InChIKey | GHEJOVTUBDNGBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C/C(=N/N)/N.Cl |
Computed by PubChem (NCBI)