CAS 57054-89-4 is the registry number for 5-Bromo-4-chloro-N,N-diethylpyrimidin-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-4-chloro-N,N-diethylpyrimidin-2-amine (CAS 57054-89-4) is a chemical compound with the molecular formula C8H11BrClN3 and a molecular weight of 264.55 g/mol. IUPAC name: 5-bromo-4-chloro-N,N-diethylpyrimidin-2-amine. InChIKey: JUQWINKMSFVHNW-UHFFFAOYSA-N.
| Molecular formula | C8H11BrClN3 |
|---|---|
| Molecular weight | 264.55 g/mol |
| IUPAC name | 5-bromo-4-chloro-N,N-diethylpyrimidin-2-amine |
| InChIKey | JUQWINKMSFVHNW-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=NC=C(C(=N1)Cl)Br |
Computed by PubChem (NCBI)