CAS 1461707-99-2 appears in our catalog under these names: N-(1-Cyano-1-(3,4-dimethoxyphenyl)ethyl)-2,2,2-trifluoroacetamide, 95%, N-(1-Cyano-1-(3,4-dimethoxyphenyl)ethyl)-2,2,2-trifluoroacetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
N-[1-cyano-1-(3,4-dimethoxyphenyl)ethyl]-2,2,2-trifluoroacetamide (CAS 1461707-99-2) is a chemical compound with the molecular formula C13H13F3N2O3 and a molecular weight of 302.25 g/mol. IUPAC name: N-[1-cyano-1-(3,4-dimethoxyphenyl)ethyl]-2,2,2-trifluoroacetamide. InChIKey: BUVNFKOAIXXHHU-UHFFFAOYSA-N.
| Molecular formula | C13H13F3N2O3 |
|---|---|
| Molecular weight | 302.25 g/mol |
| IUPAC name | N-[1-cyano-1-(3,4-dimethoxyphenyl)ethyl]-2,2,2-trifluoroacetamide |
| InChIKey | BUVNFKOAIXXHHU-UHFFFAOYSA-N |
| SMILES | CC(C#N)(C1=CC(=C(C=C1)OC)OC)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)